C18H27N3O5 — CID 87851422
2-[4-(3-oxopropyl)piperazin-1-yl]-N-(2,4,6-trimethoxyphenyl)acetamide (PubChem CID 87851422) has the molecular formula C18H27N3O5 and a molecular weight of 365.43 g/mol. Its IUPAC name is 2-[4-(3-oxopropyl)piperazin-1-yl]-N-(2,4,6-trimethoxyphenyl)acetamide.
| Compound Name | 2-[4-(3-oxopropyl)piperazin-1-yl]-N-(2,4,6-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 87851422 |
| Molecular Formula | C18H27N3O5 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 2-[4-(3-oxopropyl)piperazin-1-yl]-N-(2,4,6-trimethoxyphenyl)acetamide |
| SMILES | COc1cc(OC)c(NC(=O)CN2CCN(CCC=O)CC2)c(OC)c1 |
| InChI | InChI=1S/C18H27N3O5/c1-24-14-11-15(25-2)18(16(12-14)26-3)19-17(23)13-21-8-6-20(7-9-21)5-4-10-22/h10-12H,4-9,13H2,1-3H3,(H,19,23) |
| InChIKey | KUVDUPGIMVNHPW-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|