C17H25N3O5 — CID 87851551
4-(3-oxopropyl)-N-(2,4,6-trimethoxyphenyl)piperazine-1-carboxamide (PubChem CID 87851551) has the molecular formula C17H25N3O5 and a molecular weight of 351.40 g/mol. Its IUPAC name is 4-(3-oxopropyl)-N-(2,4,6-trimethoxyphenyl)piperazine-1-carboxamide.
| Compound Name | 4-(3-oxopropyl)-N-(2,4,6-trimethoxyphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 87851551 |
| Molecular Formula | C17H25N3O5 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 4-(3-oxopropyl)-N-(2,4,6-trimethoxyphenyl)piperazine-1-carboxamide |
| SMILES | COc1cc(OC)c(NC(=O)N2CCN(CCC=O)CC2)c(OC)c1 |
| InChI | InChI=1S/C17H25N3O5/c1-23-13-11-14(24-2)16(15(12-13)25-3)18-17(22)20-8-6-19(7-9-20)5-4-10-21/h10-12H,4-9H2,1-3H3,(H,18,22) |
| InChIKey | IBYFBIFMAYOYHC-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|