C16H26N4O4 — CID 108866656
4-(2-aminoethyl)-N-(3,4,5-trimethoxyphenyl)piperazine-1-carboxamide (PubChem CID 108866656) has the molecular formula C16H26N4O4 and a molecular weight of 338.41 g/mol. Its IUPAC name is 4-(2-aminoethyl)-N-(3,4,5-trimethoxyphenyl)piperazine-1-carboxamide.
| Compound Name | 4-(2-aminoethyl)-N-(3,4,5-trimethoxyphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 108866656 |
| Molecular Formula | C16H26N4O4 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 4-(2-aminoethyl)-N-(3,4,5-trimethoxyphenyl)piperazine-1-carboxamide |
| SMILES | COc1cc(NC(=O)N2CCN(CCN)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C16H26N4O4/c1-22-13-10-12(11-14(23-2)15(13)24-3)18-16(21)20-8-6-19(5-4-17)7-9-20/h10-11H,4-9,17H2,1-3H3,(H,18,21) |
| InChIKey | OFRBKCMCMXMKRX-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 89.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |