C23H28N4O6 — CID 19762223
N-[4-[[4-(aziridine-1-carbonylamino)-3,5-dimethoxyphenyl]methyl]-2,6-dimethoxyphenyl]aziridine-1-carboxamide (PubChem CID 19762223) has the molecular formula C23H28N4O6 and a molecular weight of 456.50 g/mol. Its IUPAC name is N-[4-[[4-(aziridine-1-carbonylamino)-3,5-dimethoxyphenyl]methyl]-2,6-dimethoxyphenyl]aziridine-1-carboxamide.
| Compound Name | N-[4-[[4-(aziridine-1-carbonylamino)-3,5-dimethoxyphenyl]methyl]-2,6-dimethoxyphenyl]aziridine-1-carboxamide |
|---|---|
| PubChem CID | 19762223 |
| Molecular Formula | C23H28N4O6 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | N-[4-[[4-(aziridine-1-carbonylamino)-3,5-dimethoxyphenyl]methyl]-2,6-dimethoxyphenyl]aziridine-1-carboxamide |
| SMILES | COc1cc(Cc2cc(OC)c(NC(=O)N3CC3)c(OC)c2)cc(OC)c1NC(=O)N1CC1 |
| InChI | InChI=1S/C23H28N4O6/c1-30-16-10-14(11-17(31-2)20(16)24-22(28)26-5-6-26)9-15-12-18(32-3)21(19(13-15)33-4)25-23(29)27-7-8-27/h10-13H,5-9H2,1-4H3,(H,24,28)(H,25,29) |
| InChIKey | AQLQSBWDMLUSTE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 101.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|