C15H19N3O2 — CID 107467260
N-(2-cyano-6-methoxyphenyl)azepane-1-carboxamide (PubChem CID 107467260) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is N-(2-cyano-6-methoxyphenyl)azepane-1-carboxamide.
| Compound Name | N-(2-cyano-6-methoxyphenyl)azepane-1-carboxamide |
|---|---|
| PubChem CID | 107467260 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | N-(2-cyano-6-methoxyphenyl)azepane-1-carboxamide |
| SMILES | COc1cccc(C#N)c1NC(=O)N1CCCCCC1 |
| InChI | InChI=1S/C15H19N3O2/c1-20-13-8-6-7-12(11-16)14(13)17-15(19)18-9-4-2-3-5-10-18/h6-8H,2-5,9-10H2,1H3,(H,17,19) |
| InChIKey | VVPNPLPKFGIXPT-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |