C16H21N3O2 — CID 107467741
2-amino-N-(2-cyano-6-methoxyphenyl)cycloheptane-1-carboxamide (PubChem CID 107467741) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 2-amino-N-(2-cyano-6-methoxyphenyl)cycloheptane-1-carboxamide.
| Compound Name | 2-amino-N-(2-cyano-6-methoxyphenyl)cycloheptane-1-carboxamide |
|---|---|
| PubChem CID | 107467741 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 2-amino-N-(2-cyano-6-methoxyphenyl)cycloheptane-1-carboxamide |
| SMILES | COc1cccc(C#N)c1NC(=O)C1CCCCCC1N |
| InChI | InChI=1S/C16H21N3O2/c1-21-14-9-5-6-11(10-17)15(14)19-16(20)12-7-3-2-4-8-13(12)18/h5-6,9,12-13H,2-4,7-8,18H2,1H3,(H,19,20) |
| InChIKey | VUOCRAMMGJJXFA-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |