C11H17NO3S — CID 115223691
2-(2,4,6-trimethoxyanilino)ethanethiol (PubChem CID 115223691) has the molecular formula C11H17NO3S and a molecular weight of 243.33 g/mol. Its IUPAC name is 2-(2,4,6-trimethoxyanilino)ethanethiol.
| Compound Name | 2-(2,4,6-trimethoxyanilino)ethanethiol |
|---|---|
| PubChem CID | 115223691 |
| Molecular Formula | C11H17NO3S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 2-(2,4,6-trimethoxyanilino)ethanethiol |
| SMILES | COc1cc(OC)c(NCCS)c(OC)c1 |
| InChI | InChI=1S/C11H17NO3S/c1-13-8-6-9(14-2)11(12-4-5-16)10(7-8)15-3/h6-7,12,16H,4-5H2,1-3H3 |
| InChIKey | SHRNWGWNKVWNBM-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|