C7H5BF5KO — CID 63675286
potassium (2,6-difluoro-4-methoxyphenyl)-trifluoroboranuide (PubChem CID 63675286) has the molecular formula C7H5BF5KO and a molecular weight of 250.02 g/mol. Its IUPAC name is potassium (2,6-difluoro-4-methoxyphenyl)-trifluoroboranuide.
| Compound Name | potassium (2,6-difluoro-4-methoxyphenyl)-trifluoroboranuide |
|---|---|
| PubChem CID | 63675286 |
| Molecular Formula | C7H5BF5KO |
| Molecular Weight | 250.02 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | potassium (2,6-difluoro-4-methoxyphenyl)-trifluoroboranuide |
| SMILES | COc1cc(F)c([B-](F)(F)F)c(F)c1.[K+] |
| InChI | InChI=1S/C7H5BF5O.K/c1-14-4-2-5(9)7(6(10)3-4)8(11,12)13;/h2-3H,1H3;/q-1;+1 |
| InChIKey | COADYOGVBLOZSQ-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.02 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|