C8H10ClF2NO — CID 162342560
(2,6-difluoro-4-methoxyphenyl)methanamine;hydrochloride (PubChem CID 162342560) has the molecular formula C8H10ClF2NO and a molecular weight of 209.62 g/mol. Its IUPAC name is (2,6-difluoro-4-methoxyphenyl)methanamine;hydrochloride.
| Compound Name | (2,6-difluoro-4-methoxyphenyl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 162342560 |
| Molecular Formula | C8H10ClF2NO |
| Molecular Weight | 209.62 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | (2,6-difluoro-4-methoxyphenyl)methanamine;hydrochloride |
| SMILES | COc1cc(F)c(CN)c(F)c1.Cl |
| InChI | InChI=1S/C8H9F2NO.ClH/c1-12-5-2-7(9)6(4-11)8(10)3-5;/h2-3H,4,11H2,1H3;1H |
| InChIKey | DWPRHLRUKXOWMS-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.62 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |