C7H7BrClF2N — CID 73012230
(4-bromo-2,6-difluorophenyl)methanamine;hydrochloride (PubChem CID 73012230) has the molecular formula C7H7BrClF2N and a molecular weight of 258.49 g/mol. Its IUPAC name is (4-bromo-2,6-difluorophenyl)methanamine;hydrochloride.
| Compound Name | (4-bromo-2,6-difluorophenyl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 73012230 |
| Molecular Formula | C7H7BrClF2N |
| Molecular Weight | 258.49 g/mol |
| Exact Mass | 256.94 |
| IUPAC Name | (4-bromo-2,6-difluorophenyl)methanamine;hydrochloride |
| SMILES | Cl.NCc1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C7H6BrF2N.ClH/c8-4-1-6(9)5(3-11)7(10)2-4;/h1-2H,3,11H2;1H |
| InChIKey | WVXBSPZRXCEBDW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.49 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |