C14H10Br2F2 — CID 139192446
5-bromo-2-[2-(4-bromophenyl)ethyl]-1,3-difluorobenzene (PubChem CID 139192446) has the molecular formula C14H10Br2F2 and a molecular weight of 376.04 g/mol. Its IUPAC name is 5-bromo-2-[2-(4-bromophenyl)ethyl]-1,3-difluorobenzene.
| Compound Name | 5-bromo-2-[2-(4-bromophenyl)ethyl]-1,3-difluorobenzene |
|---|---|
| PubChem CID | 139192446 |
| Molecular Formula | C14H10Br2F2 |
| Molecular Weight | 376.04 g/mol |
| Exact Mass | 373.91 |
| IUPAC Name | 5-bromo-2-[2-(4-bromophenyl)ethyl]-1,3-difluorobenzene |
| SMILES | Fc1cc(Br)cc(F)c1CCc1ccc(Br)cc1 |
| InChI | InChI=1S/C14H10Br2F2/c15-10-4-1-9(2-5-10)3-6-12-13(17)7-11(16)8-14(12)18/h1-2,4-5,7-8H,3,6H2 |
| InChIKey | NOLYEMCPPZBWGZ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.04 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |