C12H15BrF2 — CID 58807411
5-bromo-1,3-difluoro-2-[(3R)-3-methylpentyl]benzene (PubChem CID 58807411) has the molecular formula C12H15BrF2 and a molecular weight of 277.15 g/mol. Its IUPAC name is 5-bromo-1,3-difluoro-2-[(3R)-3-methylpentyl]benzene.
| Compound Name | 5-bromo-1,3-difluoro-2-[(3R)-3-methylpentyl]benzene |
|---|---|
| PubChem CID | 58807411 |
| Molecular Formula | C12H15BrF2 |
| Molecular Weight | 277.15 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 5-bromo-1,3-difluoro-2-[(3R)-3-methylpentyl]benzene |
| SMILES | CC[C@@H](C)CCc1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C12H15BrF2/c1-3-8(2)4-5-10-11(14)6-9(13)7-12(10)15/h6-8H,3-5H2,1-2H3/t8-/m1/s1 |
| InChIKey | KUYQVLGKBZTCFN-MRVPVSSYSA-N |
| XLogP | 4.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.15 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |