C27H48 — CID 101071559
1,3,5-tris(4-methylhexyl)benzene (PubChem CID 101071559) has the molecular formula C27H48 and a molecular weight of 372.68 g/mol. Its IUPAC name is 1,3,5-tris(4-methylhexyl)benzene.
| Compound Name | 1,3,5-tris(4-methylhexyl)benzene |
|---|---|
| PubChem CID | 101071559 |
| Molecular Formula | C27H48 |
| Molecular Weight | 372.68 g/mol |
| Exact Mass | 372.38 |
| IUPAC Name | 1,3,5-tris(4-methylhexyl)benzene |
| SMILES | CCC(C)CCCc1cc(CCCC(C)CC)cc(CCCC(C)CC)c1 |
| InChI | InChI=1S/C27H48/c1-7-22(4)13-10-16-25-19-26(17-11-14-23(5)8-2)21-27(20-25)18-12-15-24(6)9-3/h19-24H,7-18H2,1-6H3 |
| InChIKey | BHTXDKAMDHIFIW-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.68 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |