C12H16Br2 — CID 59009897
1,3-dibromo-2-(3-methylpentyl)benzene (PubChem CID 59009897) has the molecular formula C12H16Br2 and a molecular weight of 320.07 g/mol. Its IUPAC name is 1,3-dibromo-2-(3-methylpentyl)benzene.
| Compound Name | 1,3-dibromo-2-(3-methylpentyl)benzene |
|---|---|
| PubChem CID | 59009897 |
| Molecular Formula | C12H16Br2 |
| Molecular Weight | 320.07 g/mol |
| Exact Mass | 317.96 |
| IUPAC Name | 1,3-dibromo-2-(3-methylpentyl)benzene |
| SMILES | CCC(C)CCc1c(Br)cccc1Br |
| InChI | InChI=1S/C12H16Br2/c1-3-9(2)7-8-10-11(13)5-4-6-12(10)14/h4-6,9H,3,7-8H2,1-2H3 |
| InChIKey | VCNYEUKXWLPSDG-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.07 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |