C22H32 — CID 18760982
1,5-bis(3-methylpentyl)naphthalene (PubChem CID 18760982) has the molecular formula C22H32 and a molecular weight of 296.50 g/mol. Its IUPAC name is 1,5-bis(3-methylpentyl)naphthalene.
| Compound Name | 1,5-bis(3-methylpentyl)naphthalene |
|---|---|
| PubChem CID | 18760982 |
| Molecular Formula | C22H32 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | 1,5-bis(3-methylpentyl)naphthalene |
| SMILES | CCC(C)CCc1cccc2c(CCC(C)CC)cccc12 |
| InChI | InChI=1S/C22H32/c1-5-17(3)13-15-19-9-7-12-22-20(10-8-11-21(19)22)16-14-18(4)6-2/h7-12,17-18H,5-6,13-16H2,1-4H3 |
| InChIKey | HODNDHKYEWJSGI-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |