C20H34 — CID 161124006
1,2-ditert-butyl-3-(3-methylpentyl)benzene (PubChem CID 161124006) has the molecular formula C20H34 and a molecular weight of 274.49 g/mol. Its IUPAC name is 1,2-ditert-butyl-3-(3-methylpentyl)benzene.
| Compound Name | 1,2-ditert-butyl-3-(3-methylpentyl)benzene |
|---|---|
| PubChem CID | 161124006 |
| Molecular Formula | C20H34 |
| Molecular Weight | 274.49 g/mol |
| Exact Mass | 274.27 |
| IUPAC Name | 1,2-ditert-butyl-3-(3-methylpentyl)benzene |
| SMILES | CCC(C)CCc1cccc(C(C)(C)C)c1C(C)(C)C |
| InChI | InChI=1S/C20H34/c1-9-15(2)13-14-16-11-10-12-17(19(3,4)5)18(16)20(6,7)8/h10-12,15H,9,13-14H2,1-8H3 |
| InChIKey | QHOWTYISCBSNIB-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.49 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |