C20H36N2 — CID 175244658
3,5-ditert-butyl-2-(3-methylpentyl)benzene-1,4-diamine (PubChem CID 175244658) has the molecular formula C20H36N2 and a molecular weight of 304.52 g/mol. Its IUPAC name is 3,5-ditert-butyl-2-(3-methylpentyl)benzene-1,4-diamine.
| Compound Name | 3,5-ditert-butyl-2-(3-methylpentyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 175244658 |
| Molecular Formula | C20H36N2 |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.29 |
| IUPAC Name | 3,5-ditert-butyl-2-(3-methylpentyl)benzene-1,4-diamine |
| SMILES | CCC(C)CCc1c(N)cc(C(C)(C)C)c(N)c1C(C)(C)C |
| InChI | InChI=1S/C20H36N2/c1-9-13(2)10-11-14-16(21)12-15(19(3,4)5)18(22)17(14)20(6,7)8/h12-13H,9-11,21-22H2,1-8H3 |
| InChIKey | AGMQYICTPGUZRD-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|