C13H22N2 — CID 57089963
2-methyl-4-N-(3-methylpentyl)benzene-1,4-diamine (PubChem CID 57089963) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 2-methyl-4-N-(3-methylpentyl)benzene-1,4-diamine.
| Compound Name | 2-methyl-4-N-(3-methylpentyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 57089963 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 2-methyl-4-N-(3-methylpentyl)benzene-1,4-diamine |
| SMILES | CCC(C)CCNc1ccc(N)c(C)c1 |
| InChI | InChI=1S/C13H22N2/c1-4-10(2)7-8-15-12-5-6-13(14)11(3)9-12/h5-6,9-10,15H,4,7-8,14H2,1-3H3 |
| InChIKey | GYSFKSWEGYWVDX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|