C11H18N2O — CID 102694501
4-N-(2-methoxypropyl)-2-methylbenzene-1,4-diamine (PubChem CID 102694501) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 4-N-(2-methoxypropyl)-2-methylbenzene-1,4-diamine.
| Compound Name | 4-N-(2-methoxypropyl)-2-methylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 102694501 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 4-N-(2-methoxypropyl)-2-methylbenzene-1,4-diamine |
| SMILES | COC(C)CNc1ccc(N)c(C)c1 |
| InChI | InChI=1S/C11H18N2O/c1-8-6-10(4-5-11(8)12)13-7-9(2)14-3/h4-6,9,13H,7,12H2,1-3H3 |
| InChIKey | SMSZAHLVNRIYKR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|