C12H13N3O — CID 107789366
4-(2-methoxypropylamino)benzene-1,2-dicarbonitrile (PubChem CID 107789366) has the molecular formula C12H13N3O and a molecular weight of 215.26 g/mol. Its IUPAC name is 4-(2-methoxypropylamino)benzene-1,2-dicarbonitrile.
| Compound Name | 4-(2-methoxypropylamino)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 107789366 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 4-(2-methoxypropylamino)benzene-1,2-dicarbonitrile |
| SMILES | COC(C)CNc1ccc(C#N)c(C#N)c1 |
| InChI | InChI=1S/C12H13N3O/c1-9(16-2)8-15-12-4-3-10(6-13)11(5-12)7-14/h3-5,9,15H,8H2,1-2H3 |
| InChIKey | ZOFMOIGGQQXERV-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 68.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |