C17H28N2O2Si — CID 58464488
5-[[(2R)-2-[tert-butyl(dimethyl)silyl]oxypropyl]amino]-2-methoxybenzonitrile (PubChem CID 58464488) has the molecular formula C17H28N2O2Si and a molecular weight of 320.51 g/mol. Its IUPAC name is 5-[[(2R)-2-[tert-butyl(dimethyl)silyl]oxypropyl]amino]-2-methoxybenzonitrile.
| Compound Name | 5-[[(2R)-2-[tert-butyl(dimethyl)silyl]oxypropyl]amino]-2-methoxybenzonitrile |
|---|---|
| PubChem CID | 58464488 |
| Molecular Formula | C17H28N2O2Si |
| Molecular Weight | 320.51 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | 5-[[(2R)-2-[tert-butyl(dimethyl)silyl]oxypropyl]amino]-2-methoxybenzonitrile |
| SMILES | COc1ccc(NC[C@@H](C)O[Si](C)(C)C(C)(C)C)cc1C#N |
| InChI | InChI=1S/C17H28N2O2Si/c1-13(21-22(6,7)17(2,3)4)12-19-15-8-9-16(20-5)14(10-15)11-18/h8-10,13,19H,12H2,1-7H3/t13-/m1/s1 |
| InChIKey | KUKMUOHISNTOBE-CYBMUJFWSA-N |
| XLogP | 4.39 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.51 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|