About N-[2-[tert-butyl(dimethyl)silyl]oxypropyl]-4-(2,6-difluorophenyl)aniline
N-[2-[tert-butyl(dimethyl)silyl]oxypropyl]-4-(2,6-difluorophenyl)aniline (PubChem CID 67439833) has the molecular formula C21H29F2NOSi
and a molecular weight of 377.55 g/mol. Its IUPAC name is N-[2-[tert-butyl(dimethyl)silyl]oxypropyl]-4-(2,6-difluorophenyl)aniline.
Molecular Properties
| Compound Name | N-[2-[tert-butyl(dimethyl)silyl]oxypropyl]-4-(2,6-difluorophenyl)aniline |
| PubChem CID | 67439833 |
| Molecular Formula | C21H29F2NOSi |
| Molecular Weight | 377.55 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | N-[2-[tert-butyl(dimethyl)silyl]oxypropyl]-4-(2,6-difluorophenyl)aniline |
| SMILES | CC(CNc1ccc(-c2c(F)cccc2F)cc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H29F2NOSi/c1-15(25-26(5,6)21(2,3)4)14-24-17-12-10-16(11-13-17)20-18(22)8-7-9-19(20)23/h7-13,15,24H,14H2,1-6H3 |
| InChIKey | QXAMURPAWCNAAX-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.55 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[tert-butyl(dimethyl)silyl]oxypropyl]-4-(2,6-difluorophenyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[tert-butyl(dimethyl)silyl]oxypropyl]-4-(2,6-difluorophenyl)aniline?
The IUPAC name of N-[2-[tert-butyl(dimethyl)silyl]oxypropyl]-4-(2,6-difluorophenyl)aniline (CID 67439833) is N-[2-[tert-butyl(dimethyl)silyl]oxypropyl]-4-(2,6-difluorophenyl)aniline.
What is the SMILES notation for N-[2-[tert-butyl(dimethyl)silyl]oxypropyl]-4-(2,6-difluorophenyl)aniline?
The canonical SMILES for N-[2-[tert-butyl(dimethyl)silyl]oxypropyl]-4-(2,6-difluorophenyl)aniline is CC(CNc1ccc(-c2c(F)cccc2F)cc1)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of N-[2-[tert-butyl(dimethyl)silyl]oxypropyl]-4-(2,6-difluorophenyl)aniline?
The InChIKey is QXAMURPAWCNAAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29F2NOSi/c1-15(25-26(5,6)21(2,3)4)14-24-17-12-10-16(11-13-17)20-18(22)8-7-9-19(20)23/h7-13,15,24H,14H2,1-6H3.
What are the key properties of N-[2-[tert-butyl(dimethyl)silyl]oxypropyl]-4-(2,6-difluorophenyl)aniline?
N-[2-[tert-butyl(dimethyl)silyl]oxypropyl]-4-(2,6-difluorophenyl)aniline has a molecular weight of 377.55 g/mol, XLogP of 6.45, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[tert-butyl(dimethyl)silyl]oxypropyl]-4-(2,6-difluorophenyl)aniline is sourced from PubChem (CID 67439833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).