C21H29F2NOSi — CID 67439833
N-[2-[tert-butyl(dimethyl)silyl]oxypropyl]-4-(2,6-difluorophenyl)aniline (PubChem CID 67439833) has the molecular formula C21H29F2NOSi and a molecular weight of 377.55 g/mol. Its IUPAC name is N-[2-[tert-butyl(dimethyl)silyl]oxypropyl]-4-(2,6-difluorophenyl)aniline.
| Compound Name | N-[2-[tert-butyl(dimethyl)silyl]oxypropyl]-4-(2,6-difluorophenyl)aniline |
|---|---|
| PubChem CID | 67439833 |
| Molecular Formula | C21H29F2NOSi |
| Molecular Weight | 377.55 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | N-[2-[tert-butyl(dimethyl)silyl]oxypropyl]-4-(2,6-difluorophenyl)aniline |
| SMILES | CC(CNc1ccc(-c2c(F)cccc2F)cc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H29F2NOSi/c1-15(25-26(5,6)21(2,3)4)14-24-17-12-10-16(11-13-17)20-18(22)8-7-9-19(20)23/h7-13,15,24H,14H2,1-6H3 |
| InChIKey | QXAMURPAWCNAAX-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.55 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|