C11H17FN2 — CID 83955072
1-N-(4-fluorophenyl)-3-methylbutane-1,2-diamine (PubChem CID 83955072) has the molecular formula C11H17FN2 and a molecular weight of 196.27 g/mol. Its IUPAC name is 1-N-(4-fluorophenyl)-3-methylbutane-1,2-diamine.
| Compound Name | 1-N-(4-fluorophenyl)-3-methylbutane-1,2-diamine |
|---|---|
| PubChem CID | 83955072 |
| Molecular Formula | C11H17FN2 |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.14 |
| IUPAC Name | 1-N-(4-fluorophenyl)-3-methylbutane-1,2-diamine |
| SMILES | CC(C)C(N)CNc1ccc(F)cc1 |
| InChI | InChI=1S/C11H17FN2/c1-8(2)11(13)7-14-10-5-3-9(12)4-6-10/h3-6,8,11,14H,7,13H2,1-2H3 |
| InChIKey | HIEZCOAEMRMZRI-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |