C13H22N2O — CID 83961932
1-N-(4-ethoxyphenyl)-3-methylbutane-1,2-diamine (PubChem CID 83961932) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 1-N-(4-ethoxyphenyl)-3-methylbutane-1,2-diamine.
| Compound Name | 1-N-(4-ethoxyphenyl)-3-methylbutane-1,2-diamine |
|---|---|
| PubChem CID | 83961932 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 1-N-(4-ethoxyphenyl)-3-methylbutane-1,2-diamine |
| SMILES | CCOc1ccc(NCC(N)C(C)C)cc1 |
| InChI | InChI=1S/C13H22N2O/c1-4-16-12-7-5-11(6-8-12)15-9-13(14)10(2)3/h5-8,10,13,15H,4,9,14H2,1-3H3 |
| InChIKey | WFCGLLRSIWVSMP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|