C22H30O3Si — CID 18927891
4-[4-[2-[tert-butyl(dimethyl)silyl]oxypropyl]phenyl]benzoic acid (PubChem CID 18927891) has the molecular formula C22H30O3Si and a molecular weight of 370.57 g/mol. Its IUPAC name is 4-[4-[2-[tert-butyl(dimethyl)silyl]oxypropyl]phenyl]benzoic acid.
| Compound Name | 4-[4-[2-[tert-butyl(dimethyl)silyl]oxypropyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 18927891 |
| Molecular Formula | C22H30O3Si |
| Molecular Weight | 370.57 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 4-[4-[2-[tert-butyl(dimethyl)silyl]oxypropyl]phenyl]benzoic acid |
| SMILES | CC(Cc1ccc(-c2ccc(C(=O)O)cc2)cc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H30O3Si/c1-16(25-26(5,6)22(2,3)4)15-17-7-9-18(10-8-17)19-11-13-20(14-12-19)21(23)24/h7-14,16H,15H2,1-6H3,(H,23,24) |
| InChIKey | WTYCFOHDACAJRK-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.57 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|