C18H30O4Si — CID 68630096
4-[4-[tert-butyl(dimethyl)silyl]oxybutan-2-yloxymethyl]benzoic acid (PubChem CID 68630096) has the molecular formula C18H30O4Si and a molecular weight of 338.52 g/mol. Its IUPAC name is 4-[4-[tert-butyl(dimethyl)silyl]oxybutan-2-yloxymethyl]benzoic acid.
| Compound Name | 4-[4-[tert-butyl(dimethyl)silyl]oxybutan-2-yloxymethyl]benzoic acid |
|---|---|
| PubChem CID | 68630096 |
| Molecular Formula | C18H30O4Si |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 4-[4-[tert-butyl(dimethyl)silyl]oxybutan-2-yloxymethyl]benzoic acid |
| SMILES | CC(CCO[Si](C)(C)C(C)(C)C)OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C18H30O4Si/c1-14(11-12-22-23(5,6)18(2,3)4)21-13-15-7-9-16(10-8-15)17(19)20/h7-10,14H,11-13H2,1-6H3,(H,19,20) |
| InChIKey | BUAHJGPAWIKSST-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|