C37H48O2PSi+ — CID 11204825
[(2R,3R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-phenylmethoxypentyl]-triphenylphosphanium (PubChem CID 11204825) has the molecular formula C37H48O2PSi+ and a molecular weight of 583.85 g/mol. Its IUPAC name is [(2R,3R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-phenylmethoxypentyl]-triphenylphosphanium.
| Compound Name | [(2R,3R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-phenylmethoxypentyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 11204825 |
| Molecular Formula | C37H48O2PSi+ |
| Molecular Weight | 583.85 g/mol |
| Exact Mass | 583.32 |
| IUPAC Name | [(2R,3R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-phenylmethoxypentyl]-triphenylphosphanium |
| SMILES | C[C@@H](C[P+](c1ccccc1)(c1ccccc1)c1ccccc1)[C@@H](CCO[Si](C)(C)C(C)(C)C)OCc1ccccc1 |
| InChI | InChI=1S/C37H48O2PSi/c1-31(36(38-29-32-19-11-7-12-20-32)27-28-39-41(5,6)37(2,3)4)30-40(33-21-13-8-14-22-33,34-23-15-9-16-24-34)35-25-17-10-18-26-35/h7-26,31,36H,27-30H2,1-6H3/q+1/t31-,36+/m0/s1 |
| InChIKey | YSDNZRNCVIQVRU-SVXHESJVSA-N |
| XLogP | 8.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.85 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|