C20H34O4Si — CID 100966683
(2R,3R)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-2-phenylmethoxypentane-1,3-diol (PubChem CID 100966683) has the molecular formula C20H34O4Si and a molecular weight of 366.57 g/mol. Its IUPAC name is (2R,3R)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-2-phenylmethoxypentane-1,3-diol.
| Compound Name | (2R,3R)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-2-phenylmethoxypentane-1,3-diol |
|---|---|
| PubChem CID | 100966683 |
| Molecular Formula | C20H34O4Si |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | (2R,3R)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-2-phenylmethoxypentane-1,3-diol |
| SMILES | C=C[C@](CO)(OCc1ccccc1)[C@H](O)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H34O4Si/c1-7-20(16-21,23-15-17-11-9-8-10-12-17)18(22)13-14-24-25(5,6)19(2,3)4/h7-12,18,21-22H,1,13-16H2,2-6H3/t18-,20-/m1/s1 |
| InChIKey | IFJGQWMZUPMQCX-UYAOXDASSA-N |
| XLogP | 3.89 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|