C26H48O3Si2 — CID 11113361
tert-butyl-[(3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-phenylmethoxyhept-6-enoxy]-dimethylsilane (PubChem CID 11113361) has the molecular formula C26H48O3Si2 and a molecular weight of 464.84 g/mol. Its IUPAC name is tert-butyl-[(3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-phenylmethoxyhept-6-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-phenylmethoxyhept-6-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11113361 |
| Molecular Formula | C26H48O3Si2 |
| Molecular Weight | 464.84 g/mol |
| Exact Mass | 464.31 |
| IUPAC Name | tert-butyl-[(3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-phenylmethoxyhept-6-enoxy]-dimethylsilane |
| SMILES | C=C[C@@H](C[C@H](CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)OCc1ccccc1 |
| InChI | InChI=1S/C26H48O3Si2/c1-12-23(27-21-22-16-14-13-15-17-22)20-24(29-31(10,11)26(5,6)7)18-19-28-30(8,9)25(2,3)4/h12-17,23-24H,1,18-21H2,2-11H3/t23-,24-/m0/s1 |
| InChIKey | DPPOAMRHKHFCFR-ZEQRLZLVSA-N |
| XLogP | 7.95 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.84 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|