C21H38O4Si — CID 42644288
tert-butyl-[(2R,5S)-2-(methoxymethoxy)-5-phenylmethoxyhexoxy]-dimethylsilane (PubChem CID 42644288) has the molecular formula C21H38O4Si and a molecular weight of 382.62 g/mol. Its IUPAC name is tert-butyl-[(2R,5S)-2-(methoxymethoxy)-5-phenylmethoxyhexoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2R,5S)-2-(methoxymethoxy)-5-phenylmethoxyhexoxy]-dimethylsilane |
|---|---|
| PubChem CID | 42644288 |
| Molecular Formula | C21H38O4Si |
| Molecular Weight | 382.62 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | tert-butyl-[(2R,5S)-2-(methoxymethoxy)-5-phenylmethoxyhexoxy]-dimethylsilane |
| SMILES | COCO[C@H](CC[C@H](C)OCc1ccccc1)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H38O4Si/c1-18(23-15-19-11-9-8-10-12-19)13-14-20(24-17-22-5)16-25-26(6,7)21(2,3)4/h8-12,18,20H,13-17H2,1-7H3/t18-,20+/m0/s1 |
| InChIKey | IUAFUASFKKSAOO-AZUAARDMSA-N |
| XLogP | 5.38 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.62 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|