C36H59NO6SSi2 — CID 56935062
(R)-N-[(3R,4R,5S,6R)-7-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-5,6-bis(phenylmethoxy)-1-trimethylsilylhept-1-yn-4-yl]-2-methylpropane-2-sulfinamide (PubChem CID 56935062) has the molecular formula C36H59NO6SSi2 and a molecular weight of 690.11 g/mol. Its IUPAC name is (R)-N-[(3R,4R,5S,6R)-7-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-5,6-bis(phenylmethoxy)-1-trimethylsilylhept-1-yn-4-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(3R,4R,5S,6R)-7-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-5,6-bis(phenylmethoxy)-1-trimethylsilylhept-1-yn-4-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 56935062 |
| Molecular Formula | C36H59NO6SSi2 |
| Molecular Weight | 690.11 g/mol |
| Exact Mass | 689.36 |
| IUPAC Name | (R)-N-[(3R,4R,5S,6R)-7-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-5,6-bis(phenylmethoxy)-1-trimethylsilylhept-1-yn-4-yl]-2-methylpropane-2-sulfinamide |
| SMILES | COCO[C@H](C#C[Si](C)(C)C)[C@@H](N[S@](=O)C(C)(C)C)[C@H](OCc1ccccc1)[C@@H](CO[Si](C)(C)C(C)(C)C)OCc1ccccc1 |
| InChI | InChI=1S/C36H59NO6SSi2/c1-35(2,3)44(38)37-33(31(42-28-39-7)23-24-45(8,9)10)34(41-26-30-21-17-14-18-22-30)32(27-43-46(11,12)36(4,5)6)40-25-29-19-15-13-16-20-29/h13-22,31-34,37H,25-28H2,1-12H3/t31-,32-,33-,34-,44-/m1/s1 |
| InChIKey | GVWOKKNEJMUDEE-KCFOKZEWSA-N |
| XLogP | 7.47 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.11 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|