C22H37NO4SSi — CID 102281928
N-[(2S,3S,4R)-4-(methoxymethoxy)-2-phenylmethoxy-6-trimethylsilylhex-5-yn-3-yl]-2-methylpropane-2-sulfinamide (PubChem CID 102281928) has the molecular formula C22H37NO4SSi and a molecular weight of 439.69 g/mol. Its IUPAC name is N-[(2S,3S,4R)-4-(methoxymethoxy)-2-phenylmethoxy-6-trimethylsilylhex-5-yn-3-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[(2S,3S,4R)-4-(methoxymethoxy)-2-phenylmethoxy-6-trimethylsilylhex-5-yn-3-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 102281928 |
| Molecular Formula | C22H37NO4SSi |
| Molecular Weight | 439.69 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | N-[(2S,3S,4R)-4-(methoxymethoxy)-2-phenylmethoxy-6-trimethylsilylhex-5-yn-3-yl]-2-methylpropane-2-sulfinamide |
| SMILES | COCO[C@H](C#C[Si](C)(C)C)[C@@H](NS(=O)C(C)(C)C)[C@H](C)OCc1ccccc1 |
| InChI | InChI=1S/C22H37NO4SSi/c1-18(26-16-19-12-10-9-11-13-19)21(23-28(24)22(2,3)4)20(27-17-25-5)14-15-29(6,7)8/h9-13,18,20-21,23H,16-17H2,1-8H3/t18-,20+,21-,28?/m0/s1 |
| InChIKey | ZGAIVXBFLLMLMZ-ZFMUFRGESA-N |
| XLogP | 3.88 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.69 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|