C14H17F3OSi — CID 11781130
trimethyl-[(3S)-4,4,4-trifluoro-3-phenylmethoxybut-1-ynyl]silane (PubChem CID 11781130) has the molecular formula C14H17F3OSi and a molecular weight of 286.37 g/mol. Its IUPAC name is trimethyl-[(3S)-4,4,4-trifluoro-3-phenylmethoxybut-1-ynyl]silane.
| Compound Name | trimethyl-[(3S)-4,4,4-trifluoro-3-phenylmethoxybut-1-ynyl]silane |
|---|---|
| PubChem CID | 11781130 |
| Molecular Formula | C14H17F3OSi |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | trimethyl-[(3S)-4,4,4-trifluoro-3-phenylmethoxybut-1-ynyl]silane |
| SMILES | C[Si](C)(C)C#C[C@H](OCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C14H17F3OSi/c1-19(2,3)10-9-13(14(15,16)17)18-11-12-7-5-4-6-8-12/h4-8,13H,11H2,1-3H3/t13-/m0/s1 |
| InChIKey | NEWCGGBXKLHZCV-ZDUSSCGKSA-N |
| XLogP | 4.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|