C18H14F6O3 — CID 87529286
2-(1,1,1,4,4,4-hexafluoro-3-phenylmethoxybutan-2-yl)benzoic acid (PubChem CID 87529286) has the molecular formula C18H14F6O3 and a molecular weight of 392.30 g/mol. Its IUPAC name is 2-(1,1,1,4,4,4-hexafluoro-3-phenylmethoxybutan-2-yl)benzoic acid.
| Compound Name | 2-(1,1,1,4,4,4-hexafluoro-3-phenylmethoxybutan-2-yl)benzoic acid |
|---|---|
| PubChem CID | 87529286 |
| Molecular Formula | C18H14F6O3 |
| Molecular Weight | 392.30 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 2-(1,1,1,4,4,4-hexafluoro-3-phenylmethoxybutan-2-yl)benzoic acid |
| SMILES | O=C(O)c1ccccc1C(C(OCc1ccccc1)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H14F6O3/c19-17(20,21)14(12-8-4-5-9-13(12)16(25)26)15(18(22,23)24)27-10-11-6-2-1-3-7-11/h1-9,14-15H,10H2,(H,25,26) |
| InChIKey | IYFBVLVGHJIXKQ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.30 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |