C22H35NO2SSi — CID 102250228
N-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-naphthalen-1-ylethyl]-2-methylpropane-2-sulfinamide (PubChem CID 102250228) has the molecular formula C22H35NO2SSi and a molecular weight of 405.68 g/mol. Its IUPAC name is N-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-naphthalen-1-ylethyl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-naphthalen-1-ylethyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 102250228 |
| Molecular Formula | C22H35NO2SSi |
| Molecular Weight | 405.68 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | N-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-naphthalen-1-ylethyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)N[C@@H](CO[Si](C)(C)C(C)(C)C)c1cccc2ccccc12 |
| InChI | InChI=1S/C22H35NO2SSi/c1-21(2,3)26(24)23-20(16-25-27(7,8)22(4,5)6)19-15-11-13-17-12-9-10-14-18(17)19/h9-15,20,23H,16H2,1-8H3/t20-,26?/m0/s1 |
| InChIKey | JVLHODKXKLLRHR-DQUNLGLBSA-N |
| XLogP | 5.95 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.68 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|