C19H33N3O2SSi — CID 140960913
N-[2-[tert-butyl(dimethyl)silyl]oxy-1-imidazo[1,2-a]pyridin-8-ylethyl]-2-methylpropane-2-sulfinamide (PubChem CID 140960913) has the molecular formula C19H33N3O2SSi and a molecular weight of 395.65 g/mol. Its IUPAC name is N-[2-[tert-butyl(dimethyl)silyl]oxy-1-imidazo[1,2-a]pyridin-8-ylethyl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[2-[tert-butyl(dimethyl)silyl]oxy-1-imidazo[1,2-a]pyridin-8-ylethyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 140960913 |
| Molecular Formula | C19H33N3O2SSi |
| Molecular Weight | 395.65 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | N-[2-[tert-butyl(dimethyl)silyl]oxy-1-imidazo[1,2-a]pyridin-8-ylethyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)NC(CO[Si](C)(C)C(C)(C)C)c1cccn2ccnc12 |
| InChI | InChI=1S/C19H33N3O2SSi/c1-18(2,3)25(23)21-16(14-24-26(7,8)19(4,5)6)15-10-9-12-22-13-11-20-17(15)22/h9-13,16,21H,14H2,1-8H3 |
| InChIKey | BJHWRLRTXAQCOZ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.65 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|