C20H38N2O2SSi — CID 140879441
(S)-N-[(2R)-5-[tert-butyl(dimethyl)silyl]oxy-3-pyridin-2-ylpentan-2-yl]-2-methylpropane-2-sulfinamide (PubChem CID 140879441) has the molecular formula C20H38N2O2SSi and a molecular weight of 398.69 g/mol. Its IUPAC name is (S)-N-[(2R)-5-[tert-butyl(dimethyl)silyl]oxy-3-pyridin-2-ylpentan-2-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | (S)-N-[(2R)-5-[tert-butyl(dimethyl)silyl]oxy-3-pyridin-2-ylpentan-2-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 140879441 |
| Molecular Formula | C20H38N2O2SSi |
| Molecular Weight | 398.69 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | (S)-N-[(2R)-5-[tert-butyl(dimethyl)silyl]oxy-3-pyridin-2-ylpentan-2-yl]-2-methylpropane-2-sulfinamide |
| SMILES | C[C@@H](N[S@@](=O)C(C)(C)C)C(CCO[Si](C)(C)C(C)(C)C)c1ccccn1 |
| InChI | InChI=1S/C20H38N2O2SSi/c1-16(22-25(23)19(2,3)4)17(18-12-10-11-14-21-18)13-15-24-26(8,9)20(5,6)7/h10-12,14,16-17,22H,13,15H2,1-9H3/t16-,17?,25+/m1/s1 |
| InChIKey | RTLVUAVMLYVWFE-WNERBTADSA-N |
| XLogP | 5.02 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.69 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|