C11H15Cl3N2OS — CID 102484760
2-methyl-N-[(1S)-2,2,2-trichloro-1-pyridin-2-ylethyl]propane-2-sulfinamide (PubChem CID 102484760) has the molecular formula C11H15Cl3N2OS and a molecular weight of 329.68 g/mol. Its IUPAC name is 2-methyl-N-[(1S)-2,2,2-trichloro-1-pyridin-2-ylethyl]propane-2-sulfinamide.
| Compound Name | 2-methyl-N-[(1S)-2,2,2-trichloro-1-pyridin-2-ylethyl]propane-2-sulfinamide |
|---|---|
| PubChem CID | 102484760 |
| Molecular Formula | C11H15Cl3N2OS |
| Molecular Weight | 329.68 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | 2-methyl-N-[(1S)-2,2,2-trichloro-1-pyridin-2-ylethyl]propane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)N[C@@H](c1ccccn1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H15Cl3N2OS/c1-10(2,3)18(17)16-9(11(12,13)14)8-6-4-5-7-15-8/h4-7,9,16H,1-3H3/t9-,18?/m0/s1 |
| InChIKey | LFIYWWGKSOPNMX-JUGYALQGSA-N |
| XLogP | 3.54 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.68 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|