C7H7F3N2O2S — CID 176830597
2-[2,2,2-trifluoro-1-(sulfinoamino)ethyl]pyridine (PubChem CID 176830597) has the molecular formula C7H7F3N2O2S and a molecular weight of 240.21 g/mol. Its IUPAC name is 2-[2,2,2-trifluoro-1-(sulfinoamino)ethyl]pyridine.
| Compound Name | 2-[2,2,2-trifluoro-1-(sulfinoamino)ethyl]pyridine |
|---|---|
| PubChem CID | 176830597 |
| Molecular Formula | C7H7F3N2O2S |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | 2-[2,2,2-trifluoro-1-(sulfinoamino)ethyl]pyridine |
| SMILES | O=S(O)NC(c1ccccn1)C(F)(F)F |
| InChI | InChI=1S/C7H7F3N2O2S/c8-7(9,10)6(12-15(13)14)5-3-1-2-4-11-5/h1-4,6,12H,(H,13,14) |
| InChIKey | DIXLEBOVAGVKPO-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|