C11H18N2OS — CID 102512777
2-methyl-N-[(1S)-1-pyridin-2-ylethyl]propane-2-sulfinamide (PubChem CID 102512777) has the molecular formula C11H18N2OS and a molecular weight of 226.34 g/mol. Its IUPAC name is 2-methyl-N-[(1S)-1-pyridin-2-ylethyl]propane-2-sulfinamide.
| Compound Name | 2-methyl-N-[(1S)-1-pyridin-2-ylethyl]propane-2-sulfinamide |
|---|---|
| PubChem CID | 102512777 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 2-methyl-N-[(1S)-1-pyridin-2-ylethyl]propane-2-sulfinamide |
| SMILES | C[C@H](NS(=O)C(C)(C)C)c1ccccn1 |
| InChI | InChI=1S/C11H18N2OS/c1-9(10-7-5-6-8-12-10)13-15(14)11(2,3)4/h5-9,13H,1-4H3/t9-,15?/m0/s1 |
| InChIKey | XZSYGIIHHQUBMF-HJULIUOESA-N |
| XLogP | 2.19 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |