C20H27IOSi — CID 173226598
tert-butyl-(4-iodo-2-naphthalen-1-ylbut-3-enoxy)-dimethylsilane (PubChem CID 173226598) has the molecular formula C20H27IOSi and a molecular weight of 438.43 g/mol. Its IUPAC name is tert-butyl-(4-iodo-2-naphthalen-1-ylbut-3-enoxy)-dimethylsilane.
| Compound Name | tert-butyl-(4-iodo-2-naphthalen-1-ylbut-3-enoxy)-dimethylsilane |
|---|---|
| PubChem CID | 173226598 |
| Molecular Formula | C20H27IOSi |
| Molecular Weight | 438.43 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | tert-butyl-(4-iodo-2-naphthalen-1-ylbut-3-enoxy)-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCC(C=CI)c1cccc2ccccc12 |
| InChI | InChI=1S/C20H27IOSi/c1-20(2,3)23(4,5)22-15-17(13-14-21)19-12-8-10-16-9-6-7-11-18(16)19/h6-14,17H,15H2,1-5H3 |
| InChIKey | NWPUPWBBYFAXAJ-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.43 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|