C24H29F5OSi — CID 57413406
tert-butyl-dimethyl-[(E,2R)-2-(2,3,4,5,6-pentafluorophenyl)-6-phenylhex-3-enoxy]silane (PubChem CID 57413406) has the molecular formula C24H29F5OSi and a molecular weight of 456.57 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(E,2R)-2-(2,3,4,5,6-pentafluorophenyl)-6-phenylhex-3-enoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(E,2R)-2-(2,3,4,5,6-pentafluorophenyl)-6-phenylhex-3-enoxy]silane |
|---|---|
| PubChem CID | 57413406 |
| Molecular Formula | C24H29F5OSi |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | tert-butyl-dimethyl-[(E,2R)-2-(2,3,4,5,6-pentafluorophenyl)-6-phenylhex-3-enoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H](/C=C/CCc1ccccc1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C24H29F5OSi/c1-24(2,3)31(4,5)30-15-17(14-10-9-13-16-11-7-6-8-12-16)18-19(25)21(27)23(29)22(28)20(18)26/h6-8,10-12,14,17H,9,13,15H2,1-5H3/b14-10+/t17-/m0/s1 |
| InChIKey | HEKLBJQUIYDHGG-SHRNQRGKSA-N |
| XLogP | 7.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|