C24H33NO3Si — CID 102522547
[(E,2S)-1-[tert-butyl(dimethyl)silyl]oxy-6-phenylhex-3-en-2-yl] pyridine-2-carboxylate (PubChem CID 102522547) has the molecular formula C24H33NO3Si and a molecular weight of 411.62 g/mol. Its IUPAC name is [(E,2S)-1-[tert-butyl(dimethyl)silyl]oxy-6-phenylhex-3-en-2-yl] pyridine-2-carboxylate.
| Compound Name | [(E,2S)-1-[tert-butyl(dimethyl)silyl]oxy-6-phenylhex-3-en-2-yl] pyridine-2-carboxylate |
|---|---|
| PubChem CID | 102522547 |
| Molecular Formula | C24H33NO3Si |
| Molecular Weight | 411.62 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | [(E,2S)-1-[tert-butyl(dimethyl)silyl]oxy-6-phenylhex-3-en-2-yl] pyridine-2-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H](/C=C/CCc1ccccc1)OC(=O)c1ccccn1 |
| InChI | InChI=1S/C24H33NO3Si/c1-24(2,3)29(4,5)27-19-21(28-23(26)22-17-11-12-18-25-22)16-10-9-15-20-13-7-6-8-14-20/h6-8,10-14,16-18,21H,9,15,19H2,1-5H3/b16-10+/t21-/m0/s1 |
| InChIKey | XKYOZHZXKLGQGO-DCINASHKSA-N |
| XLogP | 5.82 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.62 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|