C28H42O5Si — CID 102522555
[(E,2R)-2-[2,6-bis(methoxymethoxy)phenyl]-6-phenylhex-3-enoxy]-tert-butyl-dimethylsilane (PubChem CID 102522555) has the molecular formula C28H42O5Si and a molecular weight of 486.73 g/mol. Its IUPAC name is [(E,2R)-2-[2,6-bis(methoxymethoxy)phenyl]-6-phenylhex-3-enoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(E,2R)-2-[2,6-bis(methoxymethoxy)phenyl]-6-phenylhex-3-enoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 102522555 |
| Molecular Formula | C28H42O5Si |
| Molecular Weight | 486.73 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | [(E,2R)-2-[2,6-bis(methoxymethoxy)phenyl]-6-phenylhex-3-enoxy]-tert-butyl-dimethylsilane |
| SMILES | COCOc1cccc(OCOC)c1[C@@H](/C=C/CCc1ccccc1)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H42O5Si/c1-28(2,3)34(6,7)33-20-24(17-12-11-16-23-14-9-8-10-15-23)27-25(31-21-29-4)18-13-19-26(27)32-22-30-5/h8-10,12-15,17-19,24H,11,16,20-22H2,1-7H3/b17-12+/t24-/m0/s1 |
| InChIKey | WZDCSOLQMQNVOC-JYFCICGUSA-N |
| XLogP | 6.95 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.73 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|