C21H31NOSSi — CID 132602283
tert-butyl-dimethyl-[(E)-6-phenyl-2-(1,3-thiazol-2-yl)hex-3-enoxy]silane (PubChem CID 132602283) has the molecular formula C21H31NOSSi and a molecular weight of 373.64 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(E)-6-phenyl-2-(1,3-thiazol-2-yl)hex-3-enoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(E)-6-phenyl-2-(1,3-thiazol-2-yl)hex-3-enoxy]silane |
|---|---|
| PubChem CID | 132602283 |
| Molecular Formula | C21H31NOSSi |
| Molecular Weight | 373.64 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | tert-butyl-dimethyl-[(E)-6-phenyl-2-(1,3-thiazol-2-yl)hex-3-enoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OCC(/C=C/CCc1ccccc1)c1nccs1 |
| InChI | InChI=1S/C21H31NOSSi/c1-21(2,3)25(4,5)23-17-19(20-22-15-16-24-20)14-10-9-13-18-11-7-6-8-12-18/h6-8,10-12,14-16,19H,9,13,17H2,1-5H3/b14-10+ |
| InChIKey | DBBOUQOGNNFETB-GXDHUFHOSA-N |
| XLogP | 6.44 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.64 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|