C22H35NOSSi — CID 58366200
tert-butyl-dimethyl-[7-phenyl-1-(1,3-thiazol-2-yl)heptoxy]silane (PubChem CID 58366200) has the molecular formula C22H35NOSSi and a molecular weight of 389.68 g/mol. Its IUPAC name is tert-butyl-dimethyl-[7-phenyl-1-(1,3-thiazol-2-yl)heptoxy]silane.
| Compound Name | tert-butyl-dimethyl-[7-phenyl-1-(1,3-thiazol-2-yl)heptoxy]silane |
|---|---|
| PubChem CID | 58366200 |
| Molecular Formula | C22H35NOSSi |
| Molecular Weight | 389.68 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | tert-butyl-dimethyl-[7-phenyl-1-(1,3-thiazol-2-yl)heptoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OC(CCCCCCc1ccccc1)c1nccs1 |
| InChI | InChI=1S/C22H35NOSSi/c1-22(2,3)26(4,5)24-20(21-23-17-18-25-21)16-12-7-6-9-13-19-14-10-8-11-15-19/h8,10-11,14-15,17-18,20H,6-7,9,12-13,16H2,1-5H3 |
| InChIKey | UDUHLTPUDSUFIC-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.68 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|