C21H34N2O2Si — CID 58366278
tert-butyl-dimethyl-[1-(1,2,4-oxadiazol-5-yl)-7-phenylheptoxy]silane (PubChem CID 58366278) has the molecular formula C21H34N2O2Si and a molecular weight of 374.60 g/mol. Its IUPAC name is tert-butyl-dimethyl-[1-(1,2,4-oxadiazol-5-yl)-7-phenylheptoxy]silane.
| Compound Name | tert-butyl-dimethyl-[1-(1,2,4-oxadiazol-5-yl)-7-phenylheptoxy]silane |
|---|---|
| PubChem CID | 58366278 |
| Molecular Formula | C21H34N2O2Si |
| Molecular Weight | 374.60 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | tert-butyl-dimethyl-[1-(1,2,4-oxadiazol-5-yl)-7-phenylheptoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OC(CCCCCCc1ccccc1)c1ncno1 |
| InChI | InChI=1S/C21H34N2O2Si/c1-21(2,3)26(4,5)25-19(20-22-17-23-24-20)16-12-7-6-9-13-18-14-10-8-11-15-18/h8,10-11,14-15,17,19H,6-7,9,12-13,16H2,1-5H3 |
| InChIKey | RHJKQKQPBKOBTR-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.60 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|