C18H25NO2 — CID 71663754
[(3R,4E)-5,9-dimethyldeca-4,8-dien-3-yl] pyridine-2-carboxylate (PubChem CID 71663754) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is [(3R,4E)-5,9-dimethyldeca-4,8-dien-3-yl] pyridine-2-carboxylate.
| Compound Name | [(3R,4E)-5,9-dimethyldeca-4,8-dien-3-yl] pyridine-2-carboxylate |
|---|---|
| PubChem CID | 71663754 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | [(3R,4E)-5,9-dimethyldeca-4,8-dien-3-yl] pyridine-2-carboxylate |
| SMILES | CC[C@H](/C=C(\C)CCC=C(C)C)OC(=O)c1ccccn1 |
| InChI | InChI=1S/C18H25NO2/c1-5-16(13-15(4)10-8-9-14(2)3)21-18(20)17-11-6-7-12-19-17/h6-7,9,11-13,16H,5,8,10H2,1-4H3/b15-13+/t16-/m1/s1 |
| InChIKey | MTRTWLOAGSEJHQ-QJPKHSJYSA-N |
| XLogP | 4.71 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|