C18H32N2O4Si — CID 178172851
[3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropyl] N-methyl-N-(2-pyridin-2-ylethyl)carbamate (PubChem CID 178172851) has the molecular formula C18H32N2O4Si and a molecular weight of 368.55 g/mol. Its IUPAC name is [3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropyl] N-methyl-N-(2-pyridin-2-ylethyl)carbamate.
| Compound Name | [3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropyl] N-methyl-N-(2-pyridin-2-ylethyl)carbamate |
|---|---|
| PubChem CID | 178172851 |
| Molecular Formula | C18H32N2O4Si |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | [3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropyl] N-methyl-N-(2-pyridin-2-ylethyl)carbamate |
| SMILES | CN(CCc1ccccn1)C(=O)OCC(O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H32N2O4Si/c1-18(2,3)25(5,6)24-14-16(21)13-23-17(22)20(4)12-10-15-9-7-8-11-19-15/h7-9,11,16,21H,10,12-14H2,1-6H3 |
| InChIKey | OVLWKOQBJPTRLN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|