C21H25F3Si — CID 46901635
trimethyl-[(E)-5-phenyl-1-[4-(trifluoromethyl)phenyl]pent-2-enyl]silane (PubChem CID 46901635) has the molecular formula C21H25F3Si and a molecular weight of 362.51 g/mol. Its IUPAC name is trimethyl-[(E)-5-phenyl-1-[4-(trifluoromethyl)phenyl]pent-2-enyl]silane.
| Compound Name | trimethyl-[(E)-5-phenyl-1-[4-(trifluoromethyl)phenyl]pent-2-enyl]silane |
|---|---|
| PubChem CID | 46901635 |
| Molecular Formula | C21H25F3Si |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | trimethyl-[(E)-5-phenyl-1-[4-(trifluoromethyl)phenyl]pent-2-enyl]silane |
| SMILES | C[Si](C)(C)C(/C=C/CCc1ccccc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H25F3Si/c1-25(2,3)20(12-8-7-11-17-9-5-4-6-10-17)18-13-15-19(16-14-18)21(22,23)24/h4-6,8-10,12-16,20H,7,11H2,1-3H3/b12-8+ |
| InChIKey | UDZUIUIQGGHLAV-XYOKQWHBSA-N |
| XLogP | 6.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|